About 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone
1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone (PubChem CID 10929489) has the molecular formula C36H48O3
and a molecular weight of 528.78 g/mol. Its IUPAC name is 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone.
Molecular Properties
| Compound Name | 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone |
| PubChem CID | 10929489 |
| Molecular Formula | C36H48O3 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.36 |
| IUPAC Name | 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone |
| SMILES | O=C(C1C(C(=O)C23CC4CC(CC(C4)C2)C3)C1C(=O)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C36H48O3/c37-31(34-10-19-1-20(11-34)3-21(2-19)12-34)28-29(32(38)35-13-22-4-23(14-35)6-24(5-22)15-35)30(28)33(39)36-16-25-7-26(17-36)9-27(8-25)18-36/h19-30H,1-18H2 |
| InChIKey | XDGOQVISEWYSIW-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone?
The IUPAC name of 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone (CID 10929489) is 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone.
What is the SMILES notation for 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone?
The canonical SMILES for 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone is O=C(C1C(C(=O)C23CC4CC(CC(C4)C2)C3)C1C(=O)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone?
The InChIKey is XDGOQVISEWYSIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H48O3/c37-31(34-10-19-1-20(11-34)3-21(2-19)12-34)28-29(32(38)35-13-22-4-23(14-35)6-24(5-22)15-35)30(28)33(39)36-16-25-7-26(17-36)9-27(8-25)18-36/h19-30H,1-18H2.
What are the key properties of 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone?
1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone has a molecular weight of 528.78 g/mol, XLogP of 7.21, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl-[2,3-bis(adamantane-1-carbonyl)cyclopropyl]methanone is sourced from PubChem (CID 10929489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).