About CID 67738089
CID 67738089 (PubChem CID 67738089) has the molecular formula C7H7NOSn
and a molecular weight of 239.85 g/mol.
Molecular Properties
| Compound Name | CID 67738089 |
| PubChem CID | 67738089 |
| Molecular Formula | C7H7NOSn |
| Molecular Weight | 239.85 g/mol |
| Exact Mass | 240.95 |
| IUPAC Name | — |
| SMILES | NC(=O)c1ccccc1.[Sn] |
| InChI | InChI=1S/C7H7NO.Sn/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H2,8,9); |
| InChIKey | PJJWATOIYIGELT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.85 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 67738089 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67738089?
The IUPAC name of CID 67738089 (CID 67738089) is not available.
What is the SMILES notation for CID 67738089?
The canonical SMILES for CID 67738089 is NC(=O)c1ccccc1.[Sn].
What is the InChIKey of CID 67738089?
The InChIKey is PJJWATOIYIGELT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.Sn/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H2,8,9);.
What are the key properties of CID 67738089?
CID 67738089 has a molecular weight of 239.85 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67738089 is sourced from PubChem (CID 67738089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).