About benzamide;thiophene
benzamide;thiophene (PubChem CID 67043300) has the molecular formula C11H11NOS
and a molecular weight of 205.28 g/mol. Its IUPAC name is benzamide;thiophene.
Molecular Properties
| Compound Name | benzamide;thiophene |
| PubChem CID | 67043300 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | benzamide;thiophene |
| SMILES | NC(=O)c1ccccc1.c1ccsc1 |
| InChI | InChI=1S/C7H7NO.C4H4S/c8-7(9)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H,(H2,8,9);1-4H |
| InChIKey | BUNIKWLXXNQCEU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzamide;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;thiophene?
The IUPAC name of benzamide;thiophene (CID 67043300) is benzamide;thiophene.
What is the SMILES notation for benzamide;thiophene?
The canonical SMILES for benzamide;thiophene is NC(=O)c1ccccc1.c1ccsc1.
What is the InChIKey of benzamide;thiophene?
The InChIKey is BUNIKWLXXNQCEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C4H4S/c8-7(9)6-4-2-1-3-5-6;1-2-4-5-3-1/h1-5H,(H2,8,9);1-4H.
What are the key properties of benzamide;thiophene?
benzamide;thiophene has a molecular weight of 205.28 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;thiophene is sourced from PubChem (CID 67043300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).