About benzamide;dimethyltin
benzamide;dimethyltin (PubChem CID 174591280) has the molecular formula C9H13NOSn
and a molecular weight of 269.92 g/mol. Its IUPAC name is benzamide;dimethyltin.
Molecular Properties
| Compound Name | benzamide;dimethyltin |
| PubChem CID | 174591280 |
| Molecular Formula | C9H13NOSn |
| Molecular Weight | 269.92 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | benzamide;dimethyltin |
| SMILES | C[Sn]C.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H7NO.2CH3.Sn/c8-7(9)6-4-2-1-3-5-6;;;/h1-5H,(H2,8,9);2*1H3; |
| InChIKey | CWKQASSKHLHNGT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.92 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzamide;dimethyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;dimethyltin?
The IUPAC name of benzamide;dimethyltin (CID 174591280) is benzamide;dimethyltin.
What is the SMILES notation for benzamide;dimethyltin?
The canonical SMILES for benzamide;dimethyltin is C[Sn]C.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;dimethyltin?
The InChIKey is CWKQASSKHLHNGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.2CH3.Sn/c8-7(9)6-4-2-1-3-5-6;;;/h1-5H,(H2,8,9);2*1H3;.
What are the key properties of benzamide;dimethyltin?
benzamide;dimethyltin has a molecular weight of 269.92 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;dimethyltin is sourced from PubChem (CID 174591280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).