C13H15NO3P+ — CID 14787580
(1-benzylpyridin-1-ium-4-yl)methylphosphonic acid (PubChem CID 14787580) has the molecular formula C13H15NO3P+ and a molecular weight of 264.24 g/mol. Its IUPAC name is (1-benzylpyridin-1-ium-4-yl)methylphosphonic acid.
| Compound Name | (1-benzylpyridin-1-ium-4-yl)methylphosphonic acid |
|---|---|
| PubChem CID | 14787580 |
| Molecular Formula | C13H15NO3P+ |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (1-benzylpyridin-1-ium-4-yl)methylphosphonic acid |
| SMILES | O=P(O)(O)Cc1cc[n+](Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H14NO3P/c15-18(16,17)11-13-6-8-14(9-7-13)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H-,15,16,17)/p+1 |
| InChIKey | ZOXZVGVJGDFCLT-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 61.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|