C31H31Br2N3O6P2 — CID 159591586
[4-[[4-[5-[1-[[4-(phosphonomethyl)phenyl]methyl]pyridin-1-ium-4-yl]-2-pyridinyl]pyridin-1-ium-1-yl]methyl]phenyl]methylphosphonic acid dibromide (PubChem CID 159591586) has the molecular formula C31H31Br2N3O6P2 and a molecular weight of 763.36 g/mol. Its IUPAC name is [4-[[4-[5-[1-[[4-(phosphonomethyl)phenyl]methyl]pyridin-1-ium-4-yl]-2-pyridinyl]pyridin-1-ium-1-yl]methyl]phenyl]methylphosphonic acid dibromide.
| Compound Name | [4-[[4-[5-[1-[[4-(phosphonomethyl)phenyl]methyl]pyridin-1-ium-4-yl]-2-pyridinyl]pyridin-1-ium-1-yl]methyl]phenyl]methylphosphonic acid dibromide |
|---|---|
| PubChem CID | 159591586 |
| Molecular Formula | C31H31Br2N3O6P2 |
| Molecular Weight | 763.36 g/mol |
| Exact Mass | 761.01 |
| IUPAC Name | [4-[[4-[5-[1-[[4-(phosphonomethyl)phenyl]methyl]pyridin-1-ium-4-yl]-2-pyridinyl]pyridin-1-ium-1-yl]methyl]phenyl]methylphosphonic acid dibromide |
| SMILES | O=P(O)(O)Cc1ccc(C[n+]2ccc(-c3ccc(-c4cc[n+](Cc5ccc(CP(=O)(O)O)cc5)cc4)nc3)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C31H29N3O6P2.2BrH/c35-41(36,37)22-26-5-1-24(2-6-26)20-33-15-11-28(12-16-33)30-9-10-31(32-19-30)29-13-17-34(18-14-29)21-25-3-7-27(8-4-25)23-42(38,39)40;;/h1-19H,20-23H2,(H2-2,35,36,37,38,39,40);2*1H |
| InChIKey | SOJBDXIYCSWBIN-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.36 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|