C23H35N3+2 — CID 158008103
2,5-bis(1-methylpyridin-1-ium-4-yl)pyridine;ethane (PubChem CID 158008103) has the molecular formula C23H35N3+2 and a molecular weight of 353.55 g/mol. Its IUPAC name is 2,5-bis(1-methylpyridin-1-ium-4-yl)pyridine;ethane.
| Compound Name | 2,5-bis(1-methylpyridin-1-ium-4-yl)pyridine;ethane |
|---|---|
| PubChem CID | 158008103 |
| Molecular Formula | C23H35N3+2 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.28 |
| IUPAC Name | 2,5-bis(1-methylpyridin-1-ium-4-yl)pyridine;ethane |
| SMILES | CC.CC.CC.C[n+]1ccc(-c2ccc(-c3cc[n+](C)cc3)nc2)cc1 |
| InChI | InChI=1S/C17H17N3.3C2H6/c1-19-9-5-14(6-10-19)16-3-4-17(18-13-16)15-7-11-20(2)12-8-15;3*1-2/h3-13H,1-2H3;3*1-2H3/q+2;;; |
| InChIKey | FENUAAMUQIBAQN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 20.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|