C34H30N4+4 — CID 102048437
4-pyridin-1-ium-4-yl-1-[[4-[4-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium (PubChem CID 102048437) has the molecular formula C34H30N4+4 and a molecular weight of 494.64 g/mol. Its IUPAC name is 4-pyridin-1-ium-4-yl-1-[[4-[4-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium.
| Compound Name | 4-pyridin-1-ium-4-yl-1-[[4-[4-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium |
|---|---|
| PubChem CID | 102048437 |
| Molecular Formula | C34H30N4+4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 4-pyridin-1-ium-4-yl-1-[[4-[4-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium |
| SMILES | c1cc(-c2cc[n+](Cc3ccc(-c4ccc(C[n+]5ccc(-c6cc[nH+]cc6)cc5)cc4)cc3)cc2)cc[nH+]1 |
| InChI | InChI=1S/C34H28N4/c1-5-29(6-2-27(1)25-37-21-13-33(14-22-37)31-9-17-35-18-10-31)30-7-3-28(4-8-30)26-38-23-15-34(16-24-38)32-11-19-36-20-12-32/h1-24H,25-26H2/q+2/p+2 |
| InChIKey | MNSHVHVDAHCOAJ-UHFFFAOYSA-P |
| XLogP | 4.99 |
| TPSA | 36.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|