About oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide
oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide (PubChem CID 141066301) has the molecular formula C12H11Br2N2OP
and a molecular weight of 390.02 g/mol. Its IUPAC name is oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide.
Molecular Properties
| Compound Name | oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide |
| PubChem CID | 141066301 |
| Molecular Formula | C12H11Br2N2OP |
| Molecular Weight | 390.02 g/mol |
| Exact Mass | 387.90 |
| IUPAC Name | oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide |
| SMILES | O=P#CC[n+]1ccc(-c2cc[nH+]cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C12H10N2OP.2BrH/c15-16-10-9-14-7-3-12(4-8-14)11-1-5-13-6-2-11;;/h1-8H,9H2;2*1H/q+1;;/p-1 |
| InChIKey | CFCPLLBFSDYIRP-UHFFFAOYSA-M |
| XLogP | -4.29 |
| TPSA | 35.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.02 |
| LogP ≤ 5 | -4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide?
The IUPAC name of oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide (CID 141066301) is oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide.
What is the SMILES notation for oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide?
The canonical SMILES for oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide is O=P#CC[n+]1ccc(-c2cc[nH+]cc2)cc1.[Br-].[Br-].
What is the InChIKey of oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide?
The InChIKey is CFCPLLBFSDYIRP-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10N2OP.2BrH/c15-16-10-9-14-7-3-12(4-8-14)11-1-5-13-6-2-11;;/h1-8H,9H2;2*1H/q+1;;/p-1.
What are the key properties of oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide?
oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide has a molecular weight of 390.02 g/mol, XLogP of -4.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-[2-(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)ethylidyne]-λ5-phosphane dibromide is sourced from PubChem (CID 141066301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).