C14H13Br2N2OP — CID 141066303
2-[4-(1-ethenylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]ethylidyne-oxo-λ5-phosphane dibromide (PubChem CID 141066303) has the molecular formula C14H13Br2N2OP and a molecular weight of 416.05 g/mol. Its IUPAC name is 2-[4-(1-ethenylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]ethylidyne-oxo-λ5-phosphane dibromide.
| Compound Name | 2-[4-(1-ethenylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]ethylidyne-oxo-λ5-phosphane dibromide |
|---|---|
| PubChem CID | 141066303 |
| Molecular Formula | C14H13Br2N2OP |
| Molecular Weight | 416.05 g/mol |
| Exact Mass | 413.91 |
| IUPAC Name | 2-[4-(1-ethenylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]ethylidyne-oxo-λ5-phosphane dibromide |
| SMILES | C=C[n+]1ccc(-c2cc[n+](CC#P=O)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C14H13N2OP.2BrH/c1-2-15-7-3-13(4-8-15)14-5-9-16(10-6-14)11-12-18-17;;/h2-10H,1,11H2;2*1H/q+2;;/p-2 |
| InChIKey | LHAGSYLIVRQUOW-UHFFFAOYSA-L |
| XLogP | -3.71 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.05 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|