C14H18N2S2+2 — CID 102347204
2-[4-[1-(2-sulfanylethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethanethiol (PubChem CID 102347204) has the molecular formula C14H18N2S2+2 and a molecular weight of 278.45 g/mol. Its IUPAC name is 2-[4-[1-(2-sulfanylethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethanethiol.
| Compound Name | 2-[4-[1-(2-sulfanylethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethanethiol |
|---|---|
| PubChem CID | 102347204 |
| Molecular Formula | C14H18N2S2+2 |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-[4-[1-(2-sulfanylethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethanethiol |
| SMILES | SCC[n+]1ccc(-c2cc[n+](CCS)cc2)cc1 |
| InChI | InChI=1S/C14H16N2S2/c17-11-9-15-5-1-13(2-6-15)14-3-7-16(8-4-14)10-12-18/h1-8H,9-12H2/p+2 |
| InChIKey | POEYFEUUPPDODN-UHFFFAOYSA-P |
| XLogP | 1.79 |
| TPSA | 7.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|