C14H16Cl2N2+2 — CID 5158745
1-(2-chloroethyl)-4-[1-(2-chloroethyl)pyridin-1-ium-4-yl]pyridin-1-ium (PubChem CID 5158745) has the molecular formula C14H16Cl2N2+2 and a molecular weight of 283.20 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-[1-(2-chloroethyl)pyridin-1-ium-4-yl]pyridin-1-ium.
| Compound Name | 1-(2-chloroethyl)-4-[1-(2-chloroethyl)pyridin-1-ium-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 5158745 |
| Molecular Formula | C14H16Cl2N2+2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-(2-chloroethyl)-4-[1-(2-chloroethyl)pyridin-1-ium-4-yl]pyridin-1-ium |
| SMILES | ClCC[n+]1ccc(-c2cc[n+](CCCl)cc2)cc1 |
| InChI | InChI=1S/C14H16Cl2N2/c15-5-11-17-7-1-13(2-8-17)14-3-9-18(10-4-14)12-6-16/h1-4,7-10H,5-6,11-12H2/q+2 |
| InChIKey | WXLVTNWRYKWJPA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|