C14H18N2O4P2 — CID 101236739
hydroxy-[2-[4-[1-[2-[hydroxy(oxido)phosphanyl]ethyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]phosphinite (PubChem CID 101236739) has the molecular formula C14H18N2O4P2 and a molecular weight of 340.26 g/mol. Its IUPAC name is hydroxy-[2-[4-[1-[2-[hydroxy(oxido)phosphanyl]ethyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]phosphinite.
| Compound Name | hydroxy-[2-[4-[1-[2-[hydroxy(oxido)phosphanyl]ethyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]phosphinite |
|---|---|
| PubChem CID | 101236739 |
| Molecular Formula | C14H18N2O4P2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | hydroxy-[2-[4-[1-[2-[hydroxy(oxido)phosphanyl]ethyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]phosphinite |
| SMILES | [O-]P(O)CC[n+]1ccc(-c2cc[n+](CCP([O-])O)cc2)cc1 |
| InChI | InChI=1S/C14H18N2O4P2/c17-21(18)11-9-15-5-1-13(2-6-15)14-3-7-16(8-4-14)10-12-22(19)20/h1-8,17,19H,9-12H2 |
| InChIKey | BHBKTNKBPYCNNU-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 94.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|