C22H38N4+4 — CID 71336311
trimethyl-[3-[4-[1-[3-(trimethylazaniumyl)propyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]azanium (PubChem CID 71336311) has the molecular formula C22H38N4+4 and a molecular weight of 358.57 g/mol. Its IUPAC name is trimethyl-[3-[4-[1-[3-(trimethylazaniumyl)propyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]azanium.
| Compound Name | trimethyl-[3-[4-[1-[3-(trimethylazaniumyl)propyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]azanium |
|---|---|
| PubChem CID | 71336311 |
| Molecular Formula | C22H38N4+4 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | trimethyl-[3-[4-[1-[3-(trimethylazaniumyl)propyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propyl]azanium |
| SMILES | C[N+](C)(C)CCC[n+]1ccc(-c2cc[n+](CCC[N+](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H38N4/c1-25(2,3)19-7-13-23-15-9-21(10-16-23)22-11-17-24(18-12-22)14-8-20-26(4,5)6/h9-12,15-18H,7-8,13-14,19-20H2,1-6H3/q+4 |
| InChIKey | RHUHAEOMZGWHEL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|