C19H26Br2N2 — CID 6538046
trimethyl-[3-[4-[(E)-2-phenylethenyl]pyridin-1-ium-1-yl]propyl]azanium dibromide (PubChem CID 6538046) has the molecular formula C19H26Br2N2 and a molecular weight of 442.24 g/mol. Its IUPAC name is trimethyl-[3-[4-[(E)-2-phenylethenyl]pyridin-1-ium-1-yl]propyl]azanium dibromide.
| Compound Name | trimethyl-[3-[4-[(E)-2-phenylethenyl]pyridin-1-ium-1-yl]propyl]azanium dibromide |
|---|---|
| PubChem CID | 6538046 |
| Molecular Formula | C19H26Br2N2 |
| Molecular Weight | 442.24 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | trimethyl-[3-[4-[(E)-2-phenylethenyl]pyridin-1-ium-1-yl]propyl]azanium dibromide |
| SMILES | C[N+](C)(C)CCC[n+]1ccc(/C=C/c2ccccc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C19H26N2.2BrH/c1-21(2,3)17-7-14-20-15-12-19(13-16-20)11-10-18-8-5-4-6-9-18;;/h4-6,8-13,15-16H,7,14,17H2,1-3H3;2*1H/q+2;;/p-2/b11-10+;; |
| InChIKey | PPNGBUNXPYHPHB-BGNBUWATSA-L |
| XLogP | -2.75 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.24 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|