C37H41N3+2 — CID 170313171
trimethyl-[3-[4-[(E)-2-[6-(3-methyl-N-(3-methylphenyl)anilino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl]azanium (PubChem CID 170313171) has the molecular formula C37H41N3+2 and a molecular weight of 527.76 g/mol. Its IUPAC name is trimethyl-[3-[4-[(E)-2-[6-(3-methyl-N-(3-methylphenyl)anilino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl]azanium.
| Compound Name | trimethyl-[3-[4-[(E)-2-[6-(3-methyl-N-(3-methylphenyl)anilino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl]azanium |
|---|---|
| PubChem CID | 170313171 |
| Molecular Formula | C37H41N3+2 |
| Molecular Weight | 527.76 g/mol |
| Exact Mass | 527.33 |
| IUPAC Name | trimethyl-[3-[4-[(E)-2-[6-(3-methyl-N-(3-methylphenyl)anilino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl]azanium |
| SMILES | Cc1cccc(N(c2cccc(C)c2)c2ccc3cc(/C=C/c4cc[n+](CCC[N+](C)(C)C)cc4)ccc3c2)c1 |
| InChI | InChI=1S/C37H41N3/c1-29-9-6-11-35(25-29)39(36-12-7-10-30(2)26-36)37-18-17-33-27-32(15-16-34(33)28-37)14-13-31-19-22-38(23-20-31)21-8-24-40(3,4)5/h6-7,9-20,22-23,25-28H,8,21,24H2,1-5H3/q+2 |
| InChIKey | JTTWVCVSVRSUFY-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.76 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|