C38H43Br2N3O2 — CID 170313183
2-hydroxyethyl-[2-hydroxy-3-[4-[(E)-2-[6-(3-methyl-N-(3-methylphenyl)anilino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl]-dimethylazanium dibromide (PubChem CID 170313183) has the molecular formula C38H43Br2N3O2 and a molecular weight of 733.59 g/mol. Its IUPAC name is 2-hydroxyethyl-[2-hydroxy-3-[4-[(E)-2-[6-(3-methyl-N-(3-methylphenyl)anilino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl]-dimethylazanium dibromide.
| Compound Name | 2-hydroxyethyl-[2-hydroxy-3-[4-[(E)-2-[6-(3-methyl-N-(3-methylphenyl)anilino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 170313183 |
| Molecular Formula | C38H43Br2N3O2 |
| Molecular Weight | 733.59 g/mol |
| Exact Mass | 731.17 |
| IUPAC Name | 2-hydroxyethyl-[2-hydroxy-3-[4-[(E)-2-[6-(3-methyl-N-(3-methylphenyl)anilino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl]-dimethylazanium dibromide |
| SMILES | Cc1cccc(N(c2cccc(C)c2)c2ccc3cc(/C=C/c4cc[n+](CC(O)C[N+](C)(C)CCO)cc4)ccc3c2)c1.[Br-].[Br-] |
| InChI | InChI=1S/C38H43N3O2.2BrH/c1-29-7-5-9-35(23-29)40(36-10-6-8-30(2)24-36)37-16-15-33-25-32(13-14-34(33)26-37)12-11-31-17-19-39(20-18-31)27-38(43)28-41(3,4)21-22-42;;/h5-20,23-26,38,42-43H,21-22,27-28H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | WDYCBLSAGJYEBV-UHFFFAOYSA-L |
| XLogP | 0.82 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.59 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|