C26H35N3+2 — CID 2733606
2-[4-[2-[6-(diethylamino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]ethyl-trimethylazanium (PubChem CID 2733606) has the molecular formula C26H35N3+2 and a molecular weight of 389.59 g/mol. Its IUPAC name is 2-[4-[2-[6-(diethylamino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]ethyl-trimethylazanium.
| Compound Name | 2-[4-[2-[6-(diethylamino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 2733606 |
| Molecular Formula | C26H35N3+2 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | 2-[4-[2-[6-(diethylamino)naphthalen-2-yl]ethenyl]pyridin-1-ium-1-yl]ethyl-trimethylazanium |
| SMILES | CCN(CC)c1ccc2cc(C=Cc3cc[n+](CC[N+](C)(C)C)cc3)ccc2c1 |
| InChI | InChI=1S/C26H35N3/c1-6-28(7-2)26-13-12-24-20-23(10-11-25(24)21-26)9-8-22-14-16-27(17-15-22)18-19-29(3,4)5/h8-17,20-21H,6-7,18-19H2,1-5H3/q+2 |
| InChIKey | MQPIBFMKDALBKZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|