C26H41BrN3+ — CID 11525775
3-[4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium bromide (PubChem CID 11525775) has the molecular formula C26H41BrN3+ and a molecular weight of 475.54 g/mol. Its IUPAC name is 3-[4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium bromide.
| Compound Name | 3-[4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium bromide |
|---|---|
| PubChem CID | 11525775 |
| Molecular Formula | C26H41BrN3+ |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 3-[4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium bromide |
| SMILES | CCN(CC)c1ccc(/C=C/c2cc[n+](CCC[N+](CC)(CC)CC)cc2)cc1.[Br-] |
| InChI | InChI=1S/C26H41N3.BrH/c1-6-28(7-2)26-16-14-24(15-17-26)12-13-25-18-21-27(22-19-25)20-11-23-29(8-3,9-4)10-5;/h12-19,21-22H,6-11,20,23H2,1-5H3;1H/q+2;/p-1 |
| InChIKey | XRVKYEWBJQVHFG-UHFFFAOYSA-M |
| XLogP | 2.26 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|