C28H47Br2N3S — CID 159792073
3-[4-[(E)-2-[5-(dibutylamino)thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide (PubChem CID 159792073) has the molecular formula C28H47Br2N3S and a molecular weight of 617.58 g/mol. Its IUPAC name is 3-[4-[(E)-2-[5-(dibutylamino)thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide.
| Compound Name | 3-[4-[(E)-2-[5-(dibutylamino)thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide |
|---|---|
| PubChem CID | 159792073 |
| Molecular Formula | C28H47Br2N3S |
| Molecular Weight | 617.58 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | 3-[4-[(E)-2-[5-(dibutylamino)thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/c2cc[n+](CCC[N+](CC)(CC)CC)cc2)s1.[Br-].[Br-] |
| InChI | InChI=1S/C28H47N3S.2BrH/c1-6-11-21-30(22-12-7-2)28-17-16-27(32-28)15-14-26-18-23-29(24-19-26)20-13-25-31(8-3,9-4)10-5;;/h14-19,23-24H,6-13,20-22,25H2,1-5H3;2*1H/q+2;;/p-2 |
| InChIKey | QCEDXSGITSAGLZ-UHFFFAOYSA-L |
| XLogP | 0.89 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.58 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|