C32H49Br2N3S2 — CID 157316473
3-[4-[(E)-2-[5-[5-(dibutylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide (PubChem CID 157316473) has the molecular formula C32H49Br2N3S2 and a molecular weight of 699.71 g/mol. Its IUPAC name is 3-[4-[(E)-2-[5-[5-(dibutylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide.
| Compound Name | 3-[4-[(E)-2-[5-[5-(dibutylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide |
|---|---|
| PubChem CID | 157316473 |
| Molecular Formula | C32H49Br2N3S2 |
| Molecular Weight | 699.71 g/mol |
| Exact Mass | 697.17 |
| IUPAC Name | 3-[4-[(E)-2-[5-[5-(dibutylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide |
| SMILES | CCCCN(CCCC)c1ccc(-c2ccc(/C=C/c3cc[n+](CCC[N+](CC)(CC)CC)cc3)s2)s1.[Br-].[Br-] |
| InChI | InChI=1S/C32H49N3S2.2BrH/c1-6-11-23-34(24-12-7-2)32-19-18-31(37-32)30-17-16-29(36-30)15-14-28-20-25-33(26-21-28)22-13-27-35(8-3,9-4)10-5;;/h14-21,25-26H,6-13,22-24,27H2,1-5H3;2*1H/q+2;;/p-2 |
| InChIKey | JENQTZJVETTWCI-UHFFFAOYSA-L |
| XLogP | 2.62 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.71 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|