C26H37N3S2+2 — CID 76569875
3-[4-[2-[5-[5-(dimethylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium (PubChem CID 76569875) has the molecular formula C26H37N3S2+2 and a molecular weight of 455.74 g/mol. Its IUPAC name is 3-[4-[2-[5-[5-(dimethylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium.
| Compound Name | 3-[4-[2-[5-[5-(dimethylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium |
|---|---|
| PubChem CID | 76569875 |
| Molecular Formula | C26H37N3S2+2 |
| Molecular Weight | 455.74 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 3-[4-[2-[5-[5-(dimethylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCC[n+]1ccc(C=Cc2ccc(-c3ccc(N(C)C)s3)s2)cc1 |
| InChI | InChI=1S/C26H37N3S2/c1-6-29(7-2,8-3)21-9-18-28-19-16-22(17-20-28)10-11-23-12-13-24(30-23)25-14-15-26(31-25)27(4)5/h10-17,19-20H,6-9,18,21H2,1-5H3/q+2 |
| InChIKey | NUDITBHVFDSZIU-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.74 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|