C28H41Br2N3S2 — CID 157341334
3-[4-[(E)-2-[5-[5-(diethylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide (PubChem CID 157341334) has the molecular formula C28H41Br2N3S2 and a molecular weight of 643.60 g/mol. Its IUPAC name is 3-[4-[(E)-2-[5-[5-(diethylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide.
| Compound Name | 3-[4-[(E)-2-[5-[5-(diethylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide |
|---|---|
| PubChem CID | 157341334 |
| Molecular Formula | C28H41Br2N3S2 |
| Molecular Weight | 643.60 g/mol |
| Exact Mass | 641.11 |
| IUPAC Name | 3-[4-[(E)-2-[5-[5-(diethylamino)thiophen-2-yl]thiophen-2-yl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide |
| SMILES | CCN(CC)c1ccc(-c2ccc(/C=C/c3cc[n+](CCC[N+](CC)(CC)CC)cc3)s2)s1.[Br-].[Br-] |
| InChI | InChI=1S/C28H41N3S2.2BrH/c1-6-30(7-2)28-17-16-27(33-28)26-15-14-25(32-26)13-12-24-18-21-29(22-19-24)20-11-23-31(8-3,9-4)10-5;;/h12-19,21-22H,6-11,20,23H2,1-5H3;2*1H/q+2;;/p-2 |
| InChIKey | VQOKNFGQBZYYLW-UHFFFAOYSA-L |
| XLogP | 1.06 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.60 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|