C20H27N2+ — CID 76565847
N,N-dimethyl-4-[2-(1-pentylpyridin-1-ium-4-yl)ethenyl]aniline (PubChem CID 76565847) has the molecular formula C20H27N2+ and a molecular weight of 295.45 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(1-pentylpyridin-1-ium-4-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-(1-pentylpyridin-1-ium-4-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 76565847 |
| Molecular Formula | C20H27N2+ |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.22 |
| IUPAC Name | N,N-dimethyl-4-[2-(1-pentylpyridin-1-ium-4-yl)ethenyl]aniline |
| SMILES | CCCCC[n+]1ccc(C=Cc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H27N2/c1-4-5-6-15-22-16-13-19(14-17-22)8-7-18-9-11-20(12-10-18)21(2)3/h7-14,16-17H,4-6,15H2,1-3H3/q+1 |
| InChIKey | QLRNORIKBAVCDF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|