C16H28N2O10 — CID 139178799
3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate (PubChem CID 139178799) has the molecular formula C16H28N2O10 and a molecular weight of 408.40 g/mol. Its IUPAC name is 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate.
| Compound Name | 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate |
|---|---|
| PubChem CID | 139178799 |
| Molecular Formula | C16H28N2O10 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate |
| SMILES | O.O.O.O.O.O.O=C([O-])CC[n+]1ccc(-c2cc[n+](CCC(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H16N2O4.6H2O/c19-15(20)5-11-17-7-1-13(2-8-17)14-3-9-18(10-4-14)12-6-16(21)22;;;;;;/h1-4,7-10H,5-6,11-12H2;6*1H2 |
| InChIKey | IPLRDKRDEDEAHE-UHFFFAOYSA-N |
| XLogP | -6.74 |
| TPSA | 277.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | -6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|