About 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate
3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate (PubChem CID 139178799) has the molecular formula C16H28N2O10
and a molecular weight of 408.40 g/mol. Its IUPAC name is 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate.
Molecular Properties
| Compound Name | 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate |
| PubChem CID | 139178799 |
| Molecular Formula | C16H28N2O10 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate |
| SMILES | O.O.O.O.O.O.O=C([O-])CC[n+]1ccc(-c2cc[n+](CCC(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H16N2O4.6H2O/c19-15(20)5-11-17-7-1-13(2-8-17)14-3-9-18(10-4-14)12-6-16(21)22;;;;;;/h1-4,7-10H,5-6,11-12H2;6*1H2 |
| InChIKey | IPLRDKRDEDEAHE-UHFFFAOYSA-N |
| XLogP | -6.74 |
| TPSA | 277.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | -6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate?
The IUPAC name of 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate (CID 139178799) is 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate.
What is the SMILES notation for 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate?
The canonical SMILES for 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate is O.O.O.O.O.O.O=C([O-])CC[n+]1ccc(-c2cc[n+](CCC(=O)[O-])cc2)cc1.
What is the InChIKey of 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate?
The InChIKey is IPLRDKRDEDEAHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O4.6H2O/c19-15(20)5-11-17-7-1-13(2-8-17)14-3-9-18(10-4-14)12-6-16(21)22;;;;;;/h1-4,7-10H,5-6,11-12H2;6*1H2.
What are the key properties of 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate?
3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate has a molecular weight of 408.40 g/mol, XLogP of -6.74, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[1-(2-carboxylatoethyl)pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]propanoate;hexahydrate is sourced from PubChem (CID 139178799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).