C22H32Br2N2 — CID 72696578
1-methyl-4-(1-undec-10-enylpyridin-1-ium-4-yl)pyridin-1-ium dibromide (PubChem CID 72696578) has the molecular formula C22H32Br2N2 and a molecular weight of 484.32 g/mol. Its IUPAC name is 1-methyl-4-(1-undec-10-enylpyridin-1-ium-4-yl)pyridin-1-ium dibromide.
| Compound Name | 1-methyl-4-(1-undec-10-enylpyridin-1-ium-4-yl)pyridin-1-ium dibromide |
|---|---|
| PubChem CID | 72696578 |
| Molecular Formula | C22H32Br2N2 |
| Molecular Weight | 484.32 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 1-methyl-4-(1-undec-10-enylpyridin-1-ium-4-yl)pyridin-1-ium dibromide |
| SMILES | C=CCCCCCCCCC[n+]1ccc(-c2cc[n+](C)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C22H32N2.2BrH/c1-3-4-5-6-7-8-9-10-11-16-24-19-14-22(15-20-24)21-12-17-23(2)18-13-21;;/h3,12-15,17-20H,1,4-11,16H2,2H3;2*1H/q+2;;/p-2 |
| InChIKey | MOMHXAJTWYBARZ-UHFFFAOYSA-L |
| XLogP | -1.22 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.32 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|