C64H70N8+4 — CID 135837143
5,10,15,20-tetrakis(1-hex-5-enylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin (PubChem CID 135837143) has the molecular formula C64H70N8+4 and a molecular weight of 951.32 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(1-hex-5-enylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(1-hex-5-enylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135837143 |
| Molecular Formula | C64H70N8+4 |
| Molecular Weight | 951.32 g/mol |
| Exact Mass | 950.57 |
| IUPAC Name | 5,10,15,20-tetrakis(1-hex-5-enylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin |
| SMILES | C=CCCCC[n+]1ccc(-c2c3nc(c(-c4cc[n+](CCCCC=C)cc4)c4ccc([nH]4)c(-c4cc[n+](CCCCC=C)cc4)c4nc(c(-c5cc[n+](CCCCC=C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C64H69N8/c1-5-9-13-17-37-69-41-29-49(30-42-69)61-53-21-23-55(65-53)62(50-31-43-70(44-32-50)38-18-14-10-6-2)57-25-27-59(67-57)64(52-35-47-72(48-36-52)40-20-16-12-8-4)60-28-26-58(68-60)63(56-24-22-54(61)66-56)51-33-45-71(46-34-51)39-19-15-11-7-3/h5-8,21-36,41-48H,1-4,9-20,37-40H2,(H,65,66,67,68)/q+3/p+1/b61-53-,61-54-,62-55-,62-57-,63-56-,63-58-,64-59-,64-60- |
| InChIKey | VRFOKEDHXJEVES-WJVFOVLXSA-O |
| XLogP | 13.90 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.32 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|