C55H50N4O — CID 136883755
5,10,15-triphenyl-20-(4-undec-10-enoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 136883755) has the molecular formula C55H50N4O and a molecular weight of 783.03 g/mol. Its IUPAC name is 5,10,15-triphenyl-20-(4-undec-10-enoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-triphenyl-20-(4-undec-10-enoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136883755 |
| Molecular Formula | C55H50N4O |
| Molecular Weight | 783.03 g/mol |
| Exact Mass | 782.40 |
| IUPAC Name | 5,10,15-triphenyl-20-(4-undec-10-enoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | C=CCCCCCCCCCOc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C55H50N4O/c1-2-3-4-5-6-7-8-9-19-38-60-43-28-26-42(27-29-43)55-50-36-34-48(58-50)53(40-22-15-11-16-23-40)46-32-30-44(56-46)52(39-20-13-10-14-21-39)45-31-33-47(57-45)54(41-24-17-12-18-25-41)49-35-37-51(55)59-49/h2,10-18,20-37,56,59H,1,3-9,19,38H2/b52-44-,52-45-,53-46-,53-48-,54-47-,54-49-,55-50-,55-51- |
| InChIKey | YRZAUVAVKLPFLI-DHSWGDOPSA-N |
| XLogP | 15.01 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.03 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|