C56H49N5O3 — CID 136707596
1-[8-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]octyl]pyrrolidine-2,5-dione (PubChem CID 136707596) has the molecular formula C56H49N5O3 and a molecular weight of 840.04 g/mol. Its IUPAC name is 1-[8-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]octyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[8-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]octyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 136707596 |
| Molecular Formula | C56H49N5O3 |
| Molecular Weight | 840.04 g/mol |
| Exact Mass | 839.38 |
| IUPAC Name | 1-[8-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]octyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCCCCCCCOc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C56H49N5O3/c62-51-34-35-52(63)61(51)36-14-3-1-2-4-15-37-64-42-24-22-41(23-25-42)56-49-32-30-47(59-49)54(39-18-10-6-11-19-39)45-28-26-43(57-45)53(38-16-8-5-9-17-38)44-27-29-46(58-44)55(40-20-12-7-13-21-40)48-31-33-50(56)60-48/h5-13,16-33,57,60H,1-4,14-15,34-37H2/b53-43-,53-44-,54-45-,54-47-,55-46-,55-48-,56-49-,56-50- |
| InChIKey | YEQQTMZYEZLEOD-BHXPTZGLSA-N |
| XLogP | 13.19 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.04 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|