C47H36N4O2 — CID 136693994
3-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]propan-1-ol (PubChem CID 136693994) has the molecular formula C47H36N4O2 and a molecular weight of 688.83 g/mol. Its IUPAC name is 3-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]propan-1-ol.
| Compound Name | 3-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 136693994 |
| Molecular Formula | C47H36N4O2 |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.28 |
| IUPAC Name | 3-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]propan-1-ol |
| SMILES | OCCCOc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H36N4O2/c52-29-10-30-53-35-19-17-34(18-20-35)47-42-27-25-40(50-42)45(32-13-6-2-7-14-32)38-23-21-36(48-38)44(31-11-4-1-5-12-31)37-22-24-39(49-37)46(33-15-8-3-9-16-33)41-26-28-43(47)51-41/h1-9,11-28,48,51-52H,10,29-30H2/b44-36-,44-37-,45-38-,45-40-,46-39-,46-41-,47-42-,47-43- |
| InChIKey | NVKKPMCTNPBWJB-ZQANTMHOSA-N |
| XLogP | 11.08 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|