C51H36N4OS — CID 136912126
4-[[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]methyl]benzenethiol (PubChem CID 136912126) has the molecular formula C51H36N4OS and a molecular weight of 752.94 g/mol. Its IUPAC name is 4-[[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]methyl]benzenethiol.
| Compound Name | 4-[[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]methyl]benzenethiol |
|---|---|
| PubChem CID | 136912126 |
| Molecular Formula | C51H36N4OS |
| Molecular Weight | 752.94 g/mol |
| Exact Mass | 752.26 |
| IUPAC Name | 4-[[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]methyl]benzenethiol |
| SMILES | Sc1ccc(COc2ccc(-c3c4nc(c(-c5ccccc5)c5ccc([nH]5)c(-c5ccccc5)c5nc(c(-c6ccccc6)c6ccc3[nH]6)C=C5)C=C4)cc2)cc1 |
| InChI | InChI=1S/C51H36N4OS/c57-39-22-16-33(17-23-39)32-56-38-20-18-37(19-21-38)51-46-30-28-44(54-46)49(35-12-6-2-7-13-35)42-26-24-40(52-42)48(34-10-4-1-5-11-34)41-25-27-43(53-41)50(36-14-8-3-9-15-36)45-29-31-47(51)55-45/h1-31,52,55,57H,32H2/b48-40-,48-41-,49-42-,49-44-,50-43-,50-45-,51-46-,51-47- |
| InChIKey | NIBYMSZYYAWFTG-PRWUXVGQSA-N |
| XLogP | 13.19 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.94 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|