C47H36N4OZn+2 — CID 135782729
zinc 5-[4-(ethoxymethyl)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin (PubChem CID 135782729) has the molecular formula C47H36N4OZn+2 and a molecular weight of 738.22 g/mol. Its IUPAC name is zinc 5-[4-(ethoxymethyl)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin.
| Compound Name | zinc 5-[4-(ethoxymethyl)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135782729 |
| Molecular Formula | C47H36N4OZn+2 |
| Molecular Weight | 738.22 g/mol |
| Exact Mass | 736.22 |
| IUPAC Name | zinc 5-[4-(ethoxymethyl)phenyl]-10,15,20-triphenyl-21,23-dihydroporphyrin |
| SMILES | CCOCc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C47H36N4O.Zn/c1-2-52-30-31-18-20-35(21-19-31)47-42-28-26-40(50-42)45(33-14-8-4-9-15-33)38-24-22-36(48-38)44(32-12-6-3-7-13-32)37-23-25-39(49-37)46(34-16-10-5-11-17-34)41-27-29-43(47)51-41;/h3-29,48,51H,2,30H2,1H3;/q;+2/b44-36-,44-37-,45-38-,45-40-,46-39-,46-41-,47-42-,47-43-; |
| InChIKey | RXKQFRWJZYTHPK-RUNSENEXSA-N |
| XLogP | 11.86 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.22 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|