C46H33BrN4 — CID 11593008
15-[4-(2-bromoethyl)phenyl]-5,10,20-triphenyl-21,22-dihydroporphyrin (PubChem CID 11593008) has the molecular formula C46H33BrN4 and a molecular weight of 721.70 g/mol. Its IUPAC name is 15-[4-(2-bromoethyl)phenyl]-5,10,20-triphenyl-21,22-dihydroporphyrin.
| Compound Name | 15-[4-(2-bromoethyl)phenyl]-5,10,20-triphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11593008 |
| Molecular Formula | C46H33BrN4 |
| Molecular Weight | 721.70 g/mol |
| Exact Mass | 720.19 |
| IUPAC Name | 15-[4-(2-bromoethyl)phenyl]-5,10,20-triphenyl-21,22-dihydroporphyrin |
| SMILES | BrCCc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H33BrN4/c47-29-28-30-16-18-34(19-17-30)46-41-26-24-39(50-41)44(32-12-6-2-7-13-32)37-22-20-35(48-37)43(31-10-4-1-5-11-31)36-21-23-38(49-36)45(33-14-8-3-9-15-33)40-25-27-42(46)51-40/h1-27,48-49H,28-29H2/b43-35-,43-36-,44-37-,44-39-,45-38-,45-40-,46-41-,46-42- |
| InChIKey | FUHVRTMTVFJIGX-CRLDETFASA-N |
| XLogP | 12.26 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.70 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|