C62H48I2N4 — CID 137072443
5,15-bis[4-(3-iodopropyl)phenyl]-10,20-bis(4-phenylphenyl)-21,23-dihydroporphyrin (PubChem CID 137072443) has the molecular formula C62H48I2N4 and a molecular weight of 1102.90 g/mol. Its IUPAC name is 5,15-bis[4-(3-iodopropyl)phenyl]-10,20-bis(4-phenylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis[4-(3-iodopropyl)phenyl]-10,20-bis(4-phenylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 137072443 |
| Molecular Formula | C62H48I2N4 |
| Molecular Weight | 1102.90 g/mol |
| Exact Mass | 1102.20 |
| IUPAC Name | 5,15-bis[4-(3-iodopropyl)phenyl]-10,20-bis(4-phenylphenyl)-21,23-dihydroporphyrin |
| SMILES | ICCCc1ccc(-c2c3nc(c(-c4ccc(-c5ccccc5)cc4)c4ccc([nH]4)c(-c4ccc(CCCI)cc4)c4nc(c(-c5ccc(-c6ccccc6)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C62H48I2N4/c63-39-7-9-41-15-19-47(20-16-41)59-51-31-35-55(65-51)61(49-27-23-45(24-28-49)43-11-3-1-4-12-43)56-36-32-52(66-56)60(48-21-17-42(18-22-48)10-8-40-64)54-34-38-58(68-54)62(57-37-33-53(59)67-57)50-29-25-46(26-30-50)44-13-5-2-6-14-44/h1-6,11-38,65,68H,7-10,39-40H2/b59-51-,59-53-,60-52-,60-54-,61-55-,61-56-,62-57-,62-58- |
| InChIKey | XESRESRJEXNSBN-LLZPMGHPSA-N |
| XLogP | 17.39 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1102.90 |
| LogP ≤ 5 | 17.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|