C55H53N5 — CID 136801783
5,10,15-tris(4-butylphenyl)-20-pyridin-3-yl-21,23-dihydroporphyrin (PubChem CID 136801783) has the molecular formula C55H53N5 and a molecular weight of 784.06 g/mol. Its IUPAC name is 5,10,15-tris(4-butylphenyl)-20-pyridin-3-yl-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(4-butylphenyl)-20-pyridin-3-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136801783 |
| Molecular Formula | C55H53N5 |
| Molecular Weight | 784.06 g/mol |
| Exact Mass | 783.43 |
| IUPAC Name | 5,10,15-tris(4-butylphenyl)-20-pyridin-3-yl-21,23-dihydroporphyrin |
| SMILES | CCCCc1ccc(-c2c3nc(c(-c4ccc(CCCC)cc4)c4ccc([nH]4)c(-c4cccnc4)c4nc(c(-c5ccc(CCCC)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C55H53N5/c1-4-7-11-37-15-21-40(22-16-37)52-44-27-29-46(57-44)53(41-23-17-38(18-24-41)12-8-5-2)48-31-33-50(59-48)55(43-14-10-35-56-36-43)51-34-32-49(60-51)54(47-30-28-45(52)58-47)42-25-19-39(20-26-42)13-9-6-3/h10,14-36,57,60H,4-9,11-13H2,1-3H3/b52-44-,52-45-,53-46-,53-48-,54-47-,54-49-,55-50-,55-51- |
| InChIKey | KGQYEVREOVMGOH-DHSWGDOPSA-N |
| XLogP | 14.75 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.06 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |