C60H66N8 — CID 135491288
N-butyl-4-[10,15,20-tris[4-(butylamino)phenyl]-21,23-dihydroporphyrin-5-yl]aniline (PubChem CID 135491288) has the molecular formula C60H66N8 and a molecular weight of 899.24 g/mol. Its IUPAC name is N-butyl-4-[10,15,20-tris[4-(butylamino)phenyl]-21,23-dihydroporphyrin-5-yl]aniline.
| Compound Name | N-butyl-4-[10,15,20-tris[4-(butylamino)phenyl]-21,23-dihydroporphyrin-5-yl]aniline |
|---|---|
| PubChem CID | 135491288 |
| Molecular Formula | C60H66N8 |
| Molecular Weight | 899.24 g/mol |
| Exact Mass | 898.54 |
| IUPAC Name | N-butyl-4-[10,15,20-tris[4-(butylamino)phenyl]-21,23-dihydroporphyrin-5-yl]aniline |
| SMILES | CCCCNc1ccc(-c2c3nc(c(-c4ccc(NCCCC)cc4)c4ccc([nH]4)c(-c4ccc(NCCCC)cc4)c4nc(c(-c5ccc(NCCCC)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C60H66N8/c1-5-9-37-61-45-21-13-41(14-22-45)57-49-29-31-51(65-49)58(42-15-23-46(24-16-42)62-38-10-6-2)53-33-35-55(67-53)60(44-19-27-48(28-20-44)64-40-12-8-4)56-36-34-54(68-56)59(52-32-30-50(57)66-52)43-17-25-47(26-18-43)63-39-11-7-3/h13-36,61-65,68H,5-12,37-40H2,1-4H3/b57-49-,57-50-,58-51-,58-53-,59-52-,59-54-,60-55-,60-56- |
| InChIKey | UVNVRDXSZIKZIK-NWQHMXIBSA-N |
| XLogP | 16.17 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.24 |
| LogP ≤ 5 | 16.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|