C45H29F14N5 — CID 135873211
4-[10,15-bis(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-21H-corrin-5-yl]-2,3,5,6-tetrafluoro-N-octylaniline (PubChem CID 135873211) has the molecular formula C45H29F14N5 and a molecular weight of 905.73 g/mol. Its IUPAC name is 4-[10,15-bis(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-21H-corrin-5-yl]-2,3,5,6-tetrafluoro-N-octylaniline.
| Compound Name | 4-[10,15-bis(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-21H-corrin-5-yl]-2,3,5,6-tetrafluoro-N-octylaniline |
|---|---|
| PubChem CID | 135873211 |
| Molecular Formula | C45H29F14N5 |
| Molecular Weight | 905.73 g/mol |
| Exact Mass | 905.22 |
| IUPAC Name | 4-[10,15-bis(2,3,4,5,6-pentafluorophenyl)-23,24-dihydro-21H-corrin-5-yl]-2,3,5,6-tetrafluoro-N-octylaniline |
| SMILES | CCCCCCCCNc1c(F)c(F)c(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c4ccc2[nH]4)C=C3)c(F)c1F |
| InChI | InChI=1S/C45H29F14N5/c1-2-3-4-5-6-7-16-60-45-43(58)35(50)30(36(51)44(45)59)26-20-11-9-18(62-20)17-8-10-19(61-17)25(28-31(46)37(52)41(56)38(53)32(28)47)21-12-14-23(63-21)27(24-15-13-22(26)64-24)29-33(48)39(54)42(57)40(55)34(29)49/h8-15,60-63H,2-7,16H2,1H3/b18-17-,25-19+,25-21+,26-20+,26-22+,27-23+,27-24+ |
| InChIKey | QCWPGVSNAKOPTD-OTRRKTFSSA-N |
| XLogP | 14.42 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.73 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|