C48H42F4N9+3 — CID 135433383
N'-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin-5-yl]phenyl]butane-1,4-diamine (PubChem CID 135433383) has the molecular formula C48H42F4N9+3 and a molecular weight of 820.92 g/mol. Its IUPAC name is N'-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin-5-yl]phenyl]butane-1,4-diamine.
| Compound Name | N'-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin-5-yl]phenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 135433383 |
| Molecular Formula | C48H42F4N9+3 |
| Molecular Weight | 820.92 g/mol |
| Exact Mass | 820.35 |
| IUPAC Name | N'-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin-5-yl]phenyl]butane-1,4-diamine |
| SMILES | C[n+]1ccc(-c2c3nc(c(-c4cc[n+](C)cc4)c4ccc([nH]4)c(-c4c(F)c(F)c(NCCCCN)c(F)c4F)c4nc(c(-c5cc[n+](C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H41F4N9/c1-59-22-14-28(15-23-59)39-31-6-8-33(55-31)40(29-16-24-60(2)25-17-29)35-10-12-37(57-35)42(43-44(49)46(51)48(47(52)45(43)50)54-21-5-4-20-53)38-13-11-36(58-38)41(34-9-7-32(39)56-34)30-18-26-61(3)27-19-30/h6-19,22-27H,4-5,20-21,53H2,1-3H3,(H2,54,55,56,57,58)/q+2/p+1/b39-31-,39-32-,40-33-,40-35-,41-34-,41-36-,42-37+,42-38+ |
| InChIKey | FCNJKUSEYCFSRF-UAVNSCBQSA-O |
| XLogP | 8.50 |
| TPSA | 107.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.92 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|