C44H31F5N7+3 — CID 135482049
5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin (PubChem CID 135482049) has the molecular formula C44H31F5N7+3 and a molecular weight of 752.77 g/mol. Its IUPAC name is 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135482049 |
| Molecular Formula | C44H31F5N7+3 |
| Molecular Weight | 752.77 g/mol |
| Exact Mass | 752.25 |
| IUPAC Name | 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
| SMILES | C[n+]1ccc(-c2c3nc(c(-c4cc[n+](C)cc4)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4nc(c(-c5cc[n+](C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H30F5N7/c1-54-18-12-24(13-19-54)35-27-4-6-29(50-27)36(25-14-20-55(2)21-15-25)31-8-10-33(52-31)38(39-40(45)42(47)44(49)43(48)41(39)46)34-11-9-32(53-34)37(30-7-5-28(35)51-30)26-16-22-56(3)23-17-26/h4-23H,1-3H3,(H,50,51,52,53)/q+2/p+1/b35-27-,35-28-,36-29-,36-31-,37-30-,37-32-,38-33+,38-34+ |
| InChIKey | WQCWXMUXBMYORG-YVFGNCJRSA-O |
| XLogP | 8.49 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.77 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|