C52H42F4N6O5 — CID 137181417
methyl N-[6-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]anilino]hexyl]carbamate (PubChem CID 137181417) has the molecular formula C52H42F4N6O5 and a molecular weight of 906.94 g/mol. Its IUPAC name is methyl N-[6-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]anilino]hexyl]carbamate.
| Compound Name | methyl N-[6-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]anilino]hexyl]carbamate |
|---|---|
| PubChem CID | 137181417 |
| Molecular Formula | C52H42F4N6O5 |
| Molecular Weight | 906.94 g/mol |
| Exact Mass | 906.32 |
| IUPAC Name | methyl N-[6-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]anilino]hexyl]carbamate |
| SMILES | COC(=O)NCCCCCCNc1c(F)c(F)c(-c2c3nc(c(-c4cccc(O)c4)c4ccc([nH]4)c(-c4cccc(O)c4)c4nc(c(-c5cccc(O)c5)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C52H42F4N6O5/c1-67-52(66)58-24-5-3-2-4-23-57-51-49(55)47(53)46(48(54)50(51)56)45-40-21-19-38(61-40)43(29-10-7-13-32(64)26-29)36-17-15-34(59-36)42(28-9-6-12-31(63)25-28)35-16-18-37(60-35)44(39-20-22-41(45)62-39)30-11-8-14-33(65)27-30/h6-22,25-27,57,59,62-65H,2-5,23-24H2,1H3,(H,58,66)/b42-34-,42-35-,43-36-,43-38-,44-37-,44-39-,45-40+,45-41+ |
| InChIKey | QYHWELDNZYCNSU-RLYDDWITSA-N |
| XLogP | 12.33 |
| TPSA | 168.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.94 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|