C55H54N4O6 — CID 71260780
2-hexyl-5,10,15,20-tetrakis(3-hydroxyphenyl)-3-pentyl-22,24-dihydroporphyrin-2,3-diol (PubChem CID 71260780) has the molecular formula C55H54N4O6 and a molecular weight of 867.06 g/mol. Its IUPAC name is 2-hexyl-5,10,15,20-tetrakis(3-hydroxyphenyl)-3-pentyl-22,24-dihydroporphyrin-2,3-diol.
| Compound Name | 2-hexyl-5,10,15,20-tetrakis(3-hydroxyphenyl)-3-pentyl-22,24-dihydroporphyrin-2,3-diol |
|---|---|
| PubChem CID | 71260780 |
| Molecular Formula | C55H54N4O6 |
| Molecular Weight | 867.06 g/mol |
| Exact Mass | 866.40 |
| IUPAC Name | 2-hexyl-5,10,15,20-tetrakis(3-hydroxyphenyl)-3-pentyl-22,24-dihydroporphyrin-2,3-diol |
| SMILES | CCCCCCC1(O)c2nc(c(-c3cccc(O)c3)c3ccc([nH]3)c(-c3cccc(O)c3)c3nc(c(-c4cccc(O)c4)c4ccc([nH]4)c2-c2cccc(O)c2)C=C3)C1(O)CCCCC |
| InChI | InChI=1S/C55H54N4O6/c1-3-5-7-9-29-55(65)53-51(37-17-13-21-41(63)33-37)47-27-25-45(58-47)49(35-15-11-19-39(61)31-35)43-23-22-42(56-43)48(34-14-10-18-38(60)30-34)44-24-26-46(57-44)50(36-16-12-20-40(62)32-36)52(59-53)54(55,64)28-8-6-4-2/h10-27,30-33,57-58,60-65H,3-9,28-29H2,1-2H3/b48-42-,48-44-,49-43-,49-45-,50-46-,51-47-,52-50-,53-51- |
| InChIKey | MOOKJRSNCNOHSF-ZBFRDEQJSA-N |
| XLogP | 12.60 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.06 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|