C48H46N4O3 — CID 136798653
5-heptyl-10,15,20-tris(3-methoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 136798653) has the molecular formula C48H46N4O3 and a molecular weight of 726.92 g/mol. Its IUPAC name is 5-heptyl-10,15,20-tris(3-methoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-heptyl-10,15,20-tris(3-methoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136798653 |
| Molecular Formula | C48H46N4O3 |
| Molecular Weight | 726.92 g/mol |
| Exact Mass | 726.36 |
| IUPAC Name | 5-heptyl-10,15,20-tris(3-methoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | CCCCCCCc1c2nc(c(-c3cccc(OC)c3)c3ccc([nH]3)c(-c3cccc(OC)c3)c3nc(c(-c4cccc(OC)c4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C48H46N4O3/c1-5-6-7-8-9-19-37-38-20-22-40(49-38)46(31-13-10-16-34(28-31)53-2)42-24-26-44(51-42)48(33-15-12-18-36(30-33)55-4)45-27-25-43(52-45)47(41-23-21-39(37)50-41)32-14-11-17-35(29-32)54-3/h10-18,20-30,49,52H,5-9,19H2,1-4H3/b38-37-,39-37-,46-40-,46-42-,47-41-,47-43-,48-44-,48-45- |
| InChIKey | SCECEVNQXDMZHZ-WOXFXTDMSA-N |
| XLogP | 12.20 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.92 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|