C48H38N4O8 — CID 137303704
5,10,15,20-tetrakis(3-methylperoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 137303704) has the molecular formula C48H38N4O8 and a molecular weight of 798.85 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3-methylperoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(3-methylperoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 137303704 |
| Molecular Formula | C48H38N4O8 |
| Molecular Weight | 798.85 g/mol |
| Exact Mass | 798.27 |
| IUPAC Name | 5,10,15,20-tetrakis(3-methylperoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COOc1cccc(-c2c3nc(c(-c4cccc(OOC)c4)c4ccc([nH]4)c(-c4cccc(OOC)c4)c4nc(c(-c5cccc(OOC)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C48H38N4O8/c1-53-57-33-13-5-9-29(25-33)45-37-17-19-39(49-37)46(30-10-6-14-34(26-30)58-54-2)41-21-23-43(51-41)48(32-12-8-16-36(28-32)60-56-4)44-24-22-42(52-44)47(40-20-18-38(45)50-40)31-11-7-15-35(27-31)59-55-3/h5-28,49,52H,1-4H3/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44- |
| InChIKey | HTGMMXOFZFTFEU-PJEPRTEXSA-N |
| XLogP | 11.08 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.85 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|