C48H37N5O6 — CID 135493183
2,7,12,17-tetrakis(3-methoxyphenyl)-24-nitro-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene (PubChem CID 135493183) has the molecular formula C48H37N5O6 and a molecular weight of 779.85 g/mol. Its IUPAC name is 2,7,12,17-tetrakis(3-methoxyphenyl)-24-nitro-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene.
| Compound Name | 2,7,12,17-tetrakis(3-methoxyphenyl)-24-nitro-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene |
|---|---|
| PubChem CID | 135493183 |
| Molecular Formula | C48H37N5O6 |
| Molecular Weight | 779.85 g/mol |
| Exact Mass | 779.27 |
| IUPAC Name | 2,7,12,17-tetrakis(3-methoxyphenyl)-24-nitro-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene |
| SMILES | COc1cccc(-c2c3nc(c(-c4cccc(OC)c4)c4ccc([nH]4)c(-c4cccc(OC)c4)c4c([N+](=O)[O-])c(c(-c5cccc(OC)c5)c5ccc2[nH]5)C=N4)C=C3)c1 |
| InChI | InChI=1S/C48H37N5O6/c1-56-32-13-5-9-28(23-32)43-36-27-49-47(48(36)53(54)55)46(31-12-8-16-35(26-31)59-4)42-22-21-41(52-42)45(30-11-7-15-34(25-30)58-3)40-20-19-39(51-40)44(38-18-17-37(43)50-38)29-10-6-14-33(24-29)57-2/h5-27,50,52H,1-4H3/b43-36-,43-37-,44-38-,44-39-,45-40-,45-41-,46-42-,47-46+ |
| InChIKey | YVPKMAOGCWILLC-DXXWIJSKSA-N |
| XLogP | 11.45 |
| TPSA | 136.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.85 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|