C54H40N8O4 — CID 100928996
2-[(2S,3S)-3-(dicyanomethyl)-5,10,15,20-tetrakis(3-methoxyphenyl)-2,3,22,24-tetrahydroporphyrin-2-yl]propanedinitrile (PubChem CID 100928996) has the molecular formula C54H40N8O4 and a molecular weight of 864.97 g/mol. Its IUPAC name is 2-[(2S,3S)-3-(dicyanomethyl)-5,10,15,20-tetrakis(3-methoxyphenyl)-2,3,22,24-tetrahydroporphyrin-2-yl]propanedinitrile.
| Compound Name | 2-[(2S,3S)-3-(dicyanomethyl)-5,10,15,20-tetrakis(3-methoxyphenyl)-2,3,22,24-tetrahydroporphyrin-2-yl]propanedinitrile |
|---|---|
| PubChem CID | 100928996 |
| Molecular Formula | C54H40N8O4 |
| Molecular Weight | 864.97 g/mol |
| Exact Mass | 864.32 |
| IUPAC Name | 2-[(2S,3S)-3-(dicyanomethyl)-5,10,15,20-tetrakis(3-methoxyphenyl)-2,3,22,24-tetrahydroporphyrin-2-yl]propanedinitrile |
| SMILES | COc1cccc(-c2c3nc(c(-c4cccc(OC)c4)c4ccc([nH]4)c(-c4cccc(OC)c4)c4nc(c(-c5cccc(OC)c5)c5ccc2[nH]5)[C@H](C(C#N)C#N)[C@H]4C(C#N)C#N)C=C3)c1 |
| InChI | InChI=1S/C54H40N8O4/c1-63-37-13-5-9-31(23-37)47-41-17-18-42(59-41)48(32-10-6-14-38(24-32)64-2)44-20-22-46(61-44)50(34-12-8-16-40(26-34)66-4)54-52(36(29-57)30-58)51(35(27-55)28-56)53(62-54)49(45-21-19-43(47)60-45)33-11-7-15-39(25-33)65-3/h5-26,35-36,51-52,60-61H,1-4H3/b47-41-,47-43-,48-42-,48-44-,49-45-,50-46-,53-49-,54-50-/t51-,52-/m1/s1 |
| InChIKey | LUKXHEXAQFEMJS-BCHFCPBGSA-N |
| XLogP | 11.38 |
| TPSA | 189.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.97 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |