C52H38N6O4 — CID 10843089
methyl 2-cyano-2-[(2R,3R)-3-(1-cyano-2-methoxy-2-oxoethyl)-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]acetate (PubChem CID 10843089) has the molecular formula C52H38N6O4 and a molecular weight of 810.91 g/mol. Its IUPAC name is methyl 2-cyano-2-[(2R,3R)-3-(1-cyano-2-methoxy-2-oxoethyl)-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]acetate.
| Compound Name | methyl 2-cyano-2-[(2R,3R)-3-(1-cyano-2-methoxy-2-oxoethyl)-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]acetate |
|---|---|
| PubChem CID | 10843089 |
| Molecular Formula | C52H38N6O4 |
| Molecular Weight | 810.91 g/mol |
| Exact Mass | 810.30 |
| IUPAC Name | methyl 2-cyano-2-[(2R,3R)-3-(1-cyano-2-methoxy-2-oxoethyl)-5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2-yl]acetate |
| SMILES | COC(=O)C(C#N)[C@@H]1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc([nH]4)c2-c2ccccc2)C=C3)[C@H]1C(C#N)C(=O)OC |
| InChI | InChI=1S/C52H38N6O4/c1-61-51(59)35(29-53)47-48(36(30-54)52(60)62-2)50-46(34-21-13-6-14-22-34)42-28-26-40(57-42)44(32-17-9-4-10-18-32)38-24-23-37(55-38)43(31-15-7-3-8-16-31)39-25-27-41(56-39)45(49(47)58-50)33-19-11-5-12-20-33/h3-28,35-36,47-48,56-57H,1-2H3/b43-37-,43-39-,44-38-,44-40-,45-41-,46-42-,49-45-,50-46-/t35?,36?,47-,48-/m0/s1 |
| InChIKey | XZPNJPSRDBUWGX-MLQGZZQWSA-N |
| XLogP | 10.65 |
| TPSA | 157.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.91 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |