C52H36N4O4 — CID 135443521
dimethyl 2,7,12,17-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8(27),9,11,13,15,17,19,21,23-tridecaene-21,22-dicarboxylate (PubChem CID 135443521) has the molecular formula C52H36N4O4 and a molecular weight of 780.88 g/mol. Its IUPAC name is dimethyl 2,7,12,17-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8(27),9,11,13,15,17,19,21,23-tridecaene-21,22-dicarboxylate.
| Compound Name | dimethyl 2,7,12,17-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8(27),9,11,13,15,17,19,21,23-tridecaene-21,22-dicarboxylate |
|---|---|
| PubChem CID | 135443521 |
| Molecular Formula | C52H36N4O4 |
| Molecular Weight | 780.88 g/mol |
| Exact Mass | 780.27 |
| IUPAC Name | dimethyl 2,7,12,17-tetraphenyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8(27),9,11,13,15,17,19,21,23-tridecaene-21,22-dicarboxylate |
| SMILES | COC(=O)c1cc2c(cc1C(=O)OC)-c1nc-2c(-c2ccccc2)c2ccc([nH]2)c(-c2ccccc2)c2nc(c(-c3ccccc3)c3ccc([nH]3)c1-c1ccccc1)C=C2 |
| InChI | InChI=1S/C52H36N4O4/c1-59-51(57)37-29-35-36(30-38(37)52(58)60-2)50-48(34-21-13-6-14-22-34)44-28-26-42(55-44)46(32-17-9-4-10-18-32)40-24-23-39(53-40)45(31-15-7-3-8-16-31)41-25-27-43(54-41)47(49(35)56-50)33-19-11-5-12-20-33/h3-30,54-55H,1-2H3/b45-39-,45-41-,46-40-,46-42-,47-43-,48-44-,49-47-,50-48- |
| InChIKey | KUESUVMNNWDDQM-OVWLOWEBSA-N |
| XLogP | 12.06 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.88 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |