C47H33N5 — CID 136739940
21-methyl-2,7,12,17-tetraphenyl-21,24,25,26,27-pentazahexacyclo[16.5.1.13,6.18,11.113,16.019,23]heptacosa-1(24),2,4,6,8(26),9,11,13,15,17,19,22-dodecaene (PubChem CID 136739940) has the molecular formula C47H33N5 and a molecular weight of 667.82 g/mol. Its IUPAC name is 21-methyl-2,7,12,17-tetraphenyl-21,24,25,26,27-pentazahexacyclo[16.5.1.13,6.18,11.113,16.019,23]heptacosa-1(24),2,4,6,8(26),9,11,13,15,17,19,22-dodecaene.
| Compound Name | 21-methyl-2,7,12,17-tetraphenyl-21,24,25,26,27-pentazahexacyclo[16.5.1.13,6.18,11.113,16.019,23]heptacosa-1(24),2,4,6,8(26),9,11,13,15,17,19,22-dodecaene |
|---|---|
| PubChem CID | 136739940 |
| Molecular Formula | C47H33N5 |
| Molecular Weight | 667.82 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | 21-methyl-2,7,12,17-tetraphenyl-21,24,25,26,27-pentazahexacyclo[16.5.1.13,6.18,11.113,16.019,23]heptacosa-1(24),2,4,6,8(26),9,11,13,15,17,19,22-dodecaene |
| SMILES | Cn1cc2c(c1)-c1nc-2c(-c2ccccc2)c2ccc([nH]2)c(-c2ccccc2)c2nc(c(-c3ccccc3)c3ccc([nH]3)c1-c1ccccc1)C=C2 |
| InChI | InChI=1S/C47H33N5/c1-52-28-34-35(29-52)47-45(33-20-12-5-13-21-33)41-27-25-39(50-41)43(31-16-8-3-9-17-31)37-23-22-36(48-37)42(30-14-6-2-7-15-30)38-24-26-40(49-38)44(46(34)51-47)32-18-10-4-11-19-32/h2-29,49-50H,1H3/b42-36-,42-38-,43-37-,43-39-,44-40-,45-41-,46-44-,47-45- |
| InChIKey | XKLVDNOHLGZLJX-LTBSCNPVSA-N |
| XLogP | 11.83 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.82 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |