C44H33BMnN4O3 — CID 158544247
boric acid;manganese;5,10,15,20-tetraphenyl-21,23-dihydroporphyrin (PubChem CID 158544247) has the molecular formula C44H33BMnN4O3 and a molecular weight of 731.52 g/mol. Its IUPAC name is boric acid;manganese;5,10,15,20-tetraphenyl-21,23-dihydroporphyrin.
| Compound Name | boric acid;manganese;5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 158544247 |
| Molecular Formula | C44H33BMnN4O3 |
| Molecular Weight | 731.52 g/mol |
| Exact Mass | 731.20 |
| IUPAC Name | boric acid;manganese;5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c2-c2ccccc2)C=C1.OB(O)O.[Mn] |
| InChI | InChI=1S/C44H30N4.BH3O3.Mn/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;2-1(3)4;/h1-28,45,48H;2-4H;/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-;; |
| InChIKey | HOXDJZHVMXTWTA-YKKPBKTHSA-N |
| XLogP | 9.27 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.52 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|