C44H32N4O2 — CID 136715659
(2R,3S)-5,10,15,20-tetraphenyl-2,3,21,23-tetrahydroporphyrin-2,3-diol (PubChem CID 136715659) has the molecular formula C44H32N4O2 and a molecular weight of 648.77 g/mol. Its IUPAC name is (2R,3S)-5,10,15,20-tetraphenyl-2,3,21,23-tetrahydroporphyrin-2,3-diol.
| Compound Name | (2R,3S)-5,10,15,20-tetraphenyl-2,3,21,23-tetrahydroporphyrin-2,3-diol |
|---|---|
| PubChem CID | 136715659 |
| Molecular Formula | C44H32N4O2 |
| Molecular Weight | 648.77 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | (2R,3S)-5,10,15,20-tetraphenyl-2,3,21,23-tetrahydroporphyrin-2,3-diol |
| SMILES | O[C@@H]1c2[nH]c(c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c2-c2ccccc2)C=C4)C=C3)[C@@H]1O |
| InChI | InChI=1S/C44H32N4O2/c49-43-41-39(29-17-9-3-10-18-29)35-25-23-33(46-35)37(27-13-5-1-6-14-27)31-21-22-32(45-31)38(28-15-7-2-8-16-28)34-24-26-36(47-34)40(42(48-41)44(43)50)30-19-11-4-12-20-30/h1-26,43-45,48-50H/b37-33-,38-34-,41-39-,42-40-/t43-,44+ |
| InChIKey | OXEXURZUDNNDAX-YWKSXTCASA-N |
| XLogP | 9.81 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.77 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |